C24H24F2N4O3S — CID 46333828
N-[(3-fluorophenyl)methyl]-3-[(4-fluorophenyl)sulfonylamino]-4-piperazin-1-ylbenzamide (PubChem CID 46333828) has the molecular formula C24H24F2N4O3S and a molecular weight of 486.54 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3-[(4-fluorophenyl)sulfonylamino]-4-piperazin-1-ylbenzamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-3-[(4-fluorophenyl)sulfonylamino]-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333828 |
| Molecular Formula | C24H24F2N4O3S |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3-[(4-fluorophenyl)sulfonylamino]-4-piperazin-1-ylbenzamide |
| SMILES | O=C(NCc1cccc(F)c1)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H24F2N4O3S/c25-19-5-7-21(8-6-19)34(32,33)29-22-15-18(4-9-23(22)30-12-10-27-11-13-30)24(31)28-16-17-2-1-3-20(26)14-17/h1-9,14-15,27,29H,10-13,16H2,(H,28,31) |
| InChIKey | NYKZUDMWRSWBPP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |