C20H26N4O3S — CID 46333797
3-(methanesulfonamido)-N-[(3-methylphenyl)methyl]-4-piperazin-1-ylbenzamide (PubChem CID 46333797) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-[(3-methylphenyl)methyl]-4-piperazin-1-ylbenzamide.
| Compound Name | 3-(methanesulfonamido)-N-[(3-methylphenyl)methyl]-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333797 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-(methanesulfonamido)-N-[(3-methylphenyl)methyl]-4-piperazin-1-ylbenzamide |
| SMILES | Cc1cccc(CNC(=O)c2ccc(N3CCNCC3)c(NS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C20H26N4O3S/c1-15-4-3-5-16(12-15)14-22-20(25)17-6-7-19(24-10-8-21-9-11-24)18(13-17)23-28(2,26)27/h3-7,12-13,21,23H,8-11,14H2,1-2H3,(H,22,25) |
| InChIKey | OZCXOIWPOYCIKO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |