C14H22N4O3S — CID 46333263
3-(methanesulfonamido)-N,N-dimethyl-4-piperazin-1-ylbenzamide (PubChem CID 46333263) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N,N-dimethyl-4-piperazin-1-ylbenzamide.
| Compound Name | 3-(methanesulfonamido)-N,N-dimethyl-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46333263 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-(methanesulfonamido)-N,N-dimethyl-4-piperazin-1-ylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCNCC2)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H22N4O3S/c1-17(2)14(19)11-4-5-13(18-8-6-15-7-9-18)12(10-11)16-22(3,20)21/h4-5,10,15-16H,6-9H2,1-3H3 |
| InChIKey | LLGBMDGQXAGULV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |