C21H28N6O3S — CID 46333257
N-[2-piperazin-1-yl-5-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide (PubChem CID 46333257) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[2-piperazin-1-yl-5-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide.
| Compound Name | N-[2-piperazin-1-yl-5-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 46333257 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[2-piperazin-1-yl-5-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)N2CCN(c3ccccn3)CC2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C21H28N6O3S/c1-31(29,30)24-18-16-17(5-6-19(18)25-10-8-22-9-11-25)21(28)27-14-12-26(13-15-27)20-4-2-3-7-23-20/h2-7,16,22,24H,8-15H2,1H3 |
| InChIKey | SSHYJJIZWPAFSB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |