C24H25F3N4O5S2 — CID 146062492
N-benzyl-2-piperazin-1-yl-5-(thiophen-2-ylsulfonylamino)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 146062492) has the molecular formula C24H25F3N4O5S2 and a molecular weight of 570.62 g/mol. Its IUPAC name is N-benzyl-2-piperazin-1-yl-5-(thiophen-2-ylsulfonylamino)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-benzyl-2-piperazin-1-yl-5-(thiophen-2-ylsulfonylamino)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062492 |
| Molecular Formula | C24H25F3N4O5S2 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | N-benzyl-2-piperazin-1-yl-5-(thiophen-2-ylsulfonylamino)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1ccccc1)c1cc(NS(=O)(=O)c2cccs2)ccc1N1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24N4O3S2.C2HF3O2/c27-22(24-16-17-5-2-1-3-6-17)19-15-18(25-31(28,29)21-7-4-14-30-21)8-9-20(19)26-12-10-23-11-13-26;3-2(4,5)1(6)7/h1-9,14-15,23,25H,10-13,16H2,(H,24,27);(H,6,7) |
| InChIKey | OIBYZKPPJWNMQM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|