C24H26N4O3S — CID 50822911
5-(benzenesulfonamido)-N-benzyl-2-piperazin-1-ylbenzamide (PubChem CID 50822911) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-N-benzyl-2-piperazin-1-ylbenzamide.
| Compound Name | 5-(benzenesulfonamido)-N-benzyl-2-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 50822911 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 5-(benzenesulfonamido)-N-benzyl-2-piperazin-1-ylbenzamide |
| SMILES | O=C(NCc1ccccc1)c1cc(NS(=O)(=O)c2ccccc2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C24H26N4O3S/c29-24(26-18-19-7-3-1-4-8-19)22-17-20(11-12-23(22)28-15-13-25-14-16-28)27-32(30,31)21-9-5-2-6-10-21/h1-12,17,25,27H,13-16,18H2,(H,26,29) |
| InChIKey | AJUKTCPZSUMQTG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|