C27H29F3N4O6S — CID 146062610
N-benzyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 146062610) has the molecular formula C27H29F3N4O6S and a molecular weight of 594.61 g/mol. Its IUPAC name is N-benzyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-benzyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062610 |
| Molecular Formula | C27H29F3N4O6S |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | N-benzyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(S(=O)(=O)Nc2ccc(N3CCNCC3)c(C(=O)NCc3ccccc3)c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N4O4S.C2HF3O2/c1-33-21-8-5-9-22(17-21)34(31,32)28-20-10-11-24(29-14-12-26-13-15-29)23(16-20)25(30)27-18-19-6-3-2-4-7-19;3-2(4,5)1(6)7/h2-11,16-17,26,28H,12-15,18H2,1H3,(H,27,30);(H,6,7) |
| InChIKey | JHJAMKMAGWJSLN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|