C26H35F3N4O6S — CID 146071543
N-butyl-N-ethyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 146071543) has the molecular formula C26H35F3N4O6S and a molecular weight of 588.65 g/mol. Its IUPAC name is N-butyl-N-ethyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-N-ethyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146071543 |
| Molecular Formula | C26H35F3N4O6S |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | N-butyl-N-ethyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCN(CC)C(=O)c1cc(NS(=O)(=O)c2cccc(OC)c2)ccc1N1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H34N4O4S.C2HF3O2/c1-4-6-14-27(5-2)24(29)22-17-19(10-11-23(22)28-15-12-25-13-16-28)26-33(30,31)21-9-7-8-20(18-21)32-3;3-2(4,5)1(6)7/h7-11,17-18,25-26H,4-6,12-16H2,1-3H3;(H,6,7) |
| InChIKey | KRYSWDFRHHZKDB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|