C22H26BrF3N4O6S — CID 146062449
5-[(4-bromophenyl)sulfonylamino]-N-(2-methoxyethyl)-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 146062449) has the molecular formula C22H26BrF3N4O6S and a molecular weight of 611.44 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfonylamino]-N-(2-methoxyethyl)-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(4-bromophenyl)sulfonylamino]-N-(2-methoxyethyl)-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062449 |
| Molecular Formula | C22H26BrF3N4O6S |
| Molecular Weight | 611.44 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | 5-[(4-bromophenyl)sulfonylamino]-N-(2-methoxyethyl)-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)c1cc(NS(=O)(=O)c2ccc(Br)cc2)ccc1N1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H25BrN4O4S.C2HF3O2/c1-29-13-10-23-20(26)18-14-16(4-7-19(18)25-11-8-22-9-12-25)24-30(27,28)17-5-2-15(21)3-6-17;3-2(4,5)1(6)7/h2-7,14,22,24H,8-13H2,1H3,(H,23,26);(H,6,7) |
| InChIKey | QBZFSGDULKDNAV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|