C25H33F3N4O5S — CID 146062526
N-butan-2-yl-5-[(4-ethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 146062526) has the molecular formula C25H33F3N4O5S and a molecular weight of 558.62 g/mol. Its IUPAC name is N-butan-2-yl-5-[(4-ethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butan-2-yl-5-[(4-ethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062526 |
| Molecular Formula | C25H33F3N4O5S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | N-butan-2-yl-5-[(4-ethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(N3CCNCC3)c(C(=O)NC(C)CC)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H32N4O3S.C2HF3O2/c1-4-17(3)25-23(28)21-16-19(8-11-22(21)27-14-12-24-13-15-27)26-31(29,30)20-9-6-18(5-2)7-10-20;3-2(4,5)1(6)7/h6-11,16-17,24,26H,4-5,12-15H2,1-3H3,(H,25,28);(H,6,7) |
| InChIKey | AYFHJRRXNHUTIW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|