C23H32N4O3S — CID 50822883
N-butan-2-yl-5-[(3,4-dimethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide (PubChem CID 50822883) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-butan-2-yl-5-[(3,4-dimethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide.
| Compound Name | N-butan-2-yl-5-[(3,4-dimethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 50822883 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-butan-2-yl-5-[(3,4-dimethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide |
| SMILES | CCC(C)NC(=O)c1cc(NS(=O)(=O)c2ccc(C)c(C)c2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C23H32N4O3S/c1-5-18(4)25-23(28)21-15-19(7-9-22(21)27-12-10-24-11-13-27)26-31(29,30)20-8-6-16(2)17(3)14-20/h6-9,14-15,18,24,26H,5,10-13H2,1-4H3,(H,25,28) |
| InChIKey | IXLIKXWORYUDDA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|