C24H34N4O3S — CID 92880535
N-[(2R)-butan-2-yl]-2-piperazin-1-yl-5-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide (PubChem CID 92880535) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-piperazin-1-yl-5-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-piperazin-1-yl-5-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 92880535 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-piperazin-1-yl-5-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide |
| SMILES | CC[C@@H](C)NC(=O)c1cc(NS(=O)(=O)c2cc(C)c(C)cc2C)ccc1N1CCNCC1 |
| InChI | InChI=1S/C24H34N4O3S/c1-6-19(5)26-24(29)21-15-20(7-8-22(21)28-11-9-25-10-12-28)27-32(30,31)23-14-17(3)16(2)13-18(23)4/h7-8,13-15,19,25,27H,6,9-12H2,1-5H3,(H,26,29)/t19-/m1/s1 |
| InChIKey | OCZPKYPEBFLNJO-LJQANCHMSA-N |
| XLogP | 3.35 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|