C22H30N4O3S — CID 50822497
N,N-dimethyl-2-piperazin-1-yl-5-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide (PubChem CID 50822497) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N,N-dimethyl-2-piperazin-1-yl-5-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide.
| Compound Name | N,N-dimethyl-2-piperazin-1-yl-5-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 50822497 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N,N-dimethyl-2-piperazin-1-yl-5-[(2,4,5-trimethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(N3CCNCC3)c(C(=O)N(C)C)c2)cc1C |
| InChI | InChI=1S/C22H30N4O3S/c1-15-12-17(3)21(13-16(15)2)30(28,29)24-18-6-7-20(26-10-8-23-9-11-26)19(14-18)22(27)25(4)5/h6-7,12-14,23-24H,8-11H2,1-5H3 |
| InChIKey | BWVVBJUEBVOUER-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|