C25H35FN4O3S — CID 46379655
5-[(2-fluorophenyl)sulfonylamino]-N,N-bis(2-methylpropyl)-2-piperazin-1-ylbenzamide (PubChem CID 46379655) has the molecular formula C25H35FN4O3S and a molecular weight of 490.65 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)sulfonylamino]-N,N-bis(2-methylpropyl)-2-piperazin-1-ylbenzamide.
| Compound Name | 5-[(2-fluorophenyl)sulfonylamino]-N,N-bis(2-methylpropyl)-2-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46379655 |
| Molecular Formula | C25H35FN4O3S |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 5-[(2-fluorophenyl)sulfonylamino]-N,N-bis(2-methylpropyl)-2-piperazin-1-ylbenzamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)c1cc(NS(=O)(=O)c2ccccc2F)ccc1N1CCNCC1 |
| InChI | InChI=1S/C25H35FN4O3S/c1-18(2)16-30(17-19(3)4)25(31)21-15-20(9-10-23(21)29-13-11-27-12-14-29)28-34(32,33)24-8-6-5-7-22(24)26/h5-10,15,18-19,27-28H,11-14,16-17H2,1-4H3 |
| InChIKey | JRGNOFYMAGZRHZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|