C26H38N4O3S — CID 46379578
5-[(4-methylphenyl)sulfonylamino]-N,N-bis(2-methylpropyl)-2-piperazin-1-ylbenzamide (PubChem CID 46379578) has the molecular formula C26H38N4O3S and a molecular weight of 486.68 g/mol. Its IUPAC name is 5-[(4-methylphenyl)sulfonylamino]-N,N-bis(2-methylpropyl)-2-piperazin-1-ylbenzamide.
| Compound Name | 5-[(4-methylphenyl)sulfonylamino]-N,N-bis(2-methylpropyl)-2-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46379578 |
| Molecular Formula | C26H38N4O3S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 5-[(4-methylphenyl)sulfonylamino]-N,N-bis(2-methylpropyl)-2-piperazin-1-ylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCNCC3)c(C(=O)N(CC(C)C)CC(C)C)c2)cc1 |
| InChI | InChI=1S/C26H38N4O3S/c1-19(2)17-30(18-20(3)4)26(31)24-16-22(8-11-25(24)29-14-12-27-13-15-29)28-34(32,33)23-9-6-21(5)7-10-23/h6-11,16,19-20,27-28H,12-15,17-18H2,1-5H3 |
| InChIKey | LFAYQENPGYSYAF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|