C20H25FN4O3S — CID 20972171
5-[(4-fluorophenyl)sulfonylamino]-2-piperazin-1-yl-N-propan-2-ylbenzamide (PubChem CID 20972171) has the molecular formula C20H25FN4O3S and a molecular weight of 420.51 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)sulfonylamino]-2-piperazin-1-yl-N-propan-2-ylbenzamide.
| Compound Name | 5-[(4-fluorophenyl)sulfonylamino]-2-piperazin-1-yl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 20972171 |
| Molecular Formula | C20H25FN4O3S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 5-[(4-fluorophenyl)sulfonylamino]-2-piperazin-1-yl-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cc(NS(=O)(=O)c2ccc(F)cc2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C20H25FN4O3S/c1-14(2)23-20(26)18-13-16(5-8-19(18)25-11-9-22-10-12-25)24-29(27,28)17-6-3-15(21)4-7-17/h3-8,13-14,22,24H,9-12H2,1-2H3,(H,23,26) |
| InChIKey | XSKVUTCWKYBDAV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|