C19H23BrN4O3S — CID 46379559
5-[(4-bromophenyl)sulfonylamino]-N-ethyl-2-piperazin-1-ylbenzamide (PubChem CID 46379559) has the molecular formula C19H23BrN4O3S and a molecular weight of 467.39 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfonylamino]-N-ethyl-2-piperazin-1-ylbenzamide.
| Compound Name | 5-[(4-bromophenyl)sulfonylamino]-N-ethyl-2-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46379559 |
| Molecular Formula | C19H23BrN4O3S |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 5-[(4-bromophenyl)sulfonylamino]-N-ethyl-2-piperazin-1-ylbenzamide |
| SMILES | CCNC(=O)c1cc(NS(=O)(=O)c2ccc(Br)cc2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C19H23BrN4O3S/c1-2-22-19(25)17-13-15(5-8-18(17)24-11-9-21-10-12-24)23-28(26,27)16-6-3-14(20)4-7-16/h3-8,13,21,23H,2,9-12H2,1H3,(H,22,25) |
| InChIKey | XKIFQKXKKRYYBR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|