C26H35F3N4O5S — CID 146062506
N-butyl-5-[(3,4-dimethylphenyl)sulfonylamino]-N-methyl-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 146062506) has the molecular formula C26H35F3N4O5S and a molecular weight of 572.65 g/mol. Its IUPAC name is N-butyl-5-[(3,4-dimethylphenyl)sulfonylamino]-N-methyl-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-5-[(3,4-dimethylphenyl)sulfonylamino]-N-methyl-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062506 |
| Molecular Formula | C26H35F3N4O5S |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | N-butyl-5-[(3,4-dimethylphenyl)sulfonylamino]-N-methyl-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCN(C)C(=O)c1cc(NS(=O)(=O)c2ccc(C)c(C)c2)ccc1N1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H34N4O3S.C2HF3O2/c1-5-6-13-27(4)24(29)22-17-20(8-10-23(22)28-14-11-25-12-15-28)26-32(30,31)21-9-7-18(2)19(3)16-21;3-2(4,5)1(6)7/h7-10,16-17,25-26H,5-6,11-15H2,1-4H3;(H,6,7) |
| InChIKey | XQBMLEVHSWDTOB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|