C23H29F3N4O7S — CID 146062483
5-[(2,5-dimethoxyphenyl)sulfonylamino]-N,N-dimethyl-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 146062483) has the molecular formula C23H29F3N4O7S and a molecular weight of 562.57 g/mol. Its IUPAC name is 5-[(2,5-dimethoxyphenyl)sulfonylamino]-N,N-dimethyl-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(2,5-dimethoxyphenyl)sulfonylamino]-N,N-dimethyl-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062483 |
| Molecular Formula | C23H29F3N4O7S |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 5-[(2,5-dimethoxyphenyl)sulfonylamino]-N,N-dimethyl-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(N3CCNCC3)c(C(=O)N(C)C)c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28N4O5S.C2HF3O2/c1-24(2)21(26)17-13-15(5-7-18(17)25-11-9-22-10-12-25)23-31(27,28)20-14-16(29-3)6-8-19(20)30-4;3-2(4,5)1(6)7/h5-8,13-14,22-23H,9-12H2,1-4H3;(H,6,7) |
| InChIKey | VVCHEBVHFHTVBS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|