C25H25F3N2O8S — CID 146055076
2-[benzyl(methyl)amino]-5-[(2,5-dimethoxyphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055076) has the molecular formula C25H25F3N2O8S and a molecular weight of 570.54 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-5-[(2,5-dimethoxyphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[benzyl(methyl)amino]-5-[(2,5-dimethoxyphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055076 |
| Molecular Formula | C25H25F3N2O8S |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 2-[benzyl(methyl)amino]-5-[(2,5-dimethoxyphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2ccc(N(C)Cc3ccccc3)c(C(=O)O)c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H24N2O6S.C2HF3O2/c1-25(15-16-7-5-4-6-8-16)20-11-9-17(13-19(20)23(26)27)24-32(28,29)22-14-18(30-2)10-12-21(22)31-3;3-2(4,5)1(6)7/h4-14,24H,15H2,1-3H3,(H,26,27);(H,6,7) |
| InChIKey | UDNJCUHLGLGXQF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|