C22H21ClN2O5S — CID 50766551
2-[benzyl(methyl)amino]-5-[(3-chloro-4-methoxyphenyl)sulfonylamino]benzoic acid (PubChem CID 50766551) has the molecular formula C22H21ClN2O5S and a molecular weight of 460.94 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-5-[(3-chloro-4-methoxyphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[benzyl(methyl)amino]-5-[(3-chloro-4-methoxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766551 |
| Molecular Formula | C22H21ClN2O5S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-[benzyl(methyl)amino]-5-[(3-chloro-4-methoxyphenyl)sulfonylamino]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(N(C)Cc3ccccc3)c(C(=O)O)c2)cc1Cl |
| InChI | InChI=1S/C22H21ClN2O5S/c1-25(14-15-6-4-3-5-7-15)20-10-8-16(12-18(20)22(26)27)24-31(28,29)17-9-11-21(30-2)19(23)13-17/h3-13,24H,14H2,1-2H3,(H,26,27) |
| InChIKey | NJHQHXSZMWLGRS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|