C19H23ClN2O5S — CID 50766610
2-[butyl(methyl)amino]-5-[(5-chloro-2-methoxyphenyl)sulfonylamino]benzoic acid (PubChem CID 50766610) has the molecular formula C19H23ClN2O5S and a molecular weight of 426.92 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]-5-[(5-chloro-2-methoxyphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[butyl(methyl)amino]-5-[(5-chloro-2-methoxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766610 |
| Molecular Formula | C19H23ClN2O5S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-[butyl(methyl)amino]-5-[(5-chloro-2-methoxyphenyl)sulfonylamino]benzoic acid |
| SMILES | CCCCN(C)c1ccc(NS(=O)(=O)c2cc(Cl)ccc2OC)cc1C(=O)O |
| InChI | InChI=1S/C19H23ClN2O5S/c1-4-5-10-22(2)16-8-7-14(12-15(16)19(23)24)21-28(25,26)18-11-13(20)6-9-17(18)27-3/h6-9,11-12,21H,4-5,10H2,1-3H3,(H,23,24) |
| InChIKey | AAWJQZIPNDFYFA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|