C21H25F3N2O6S — CID 146054998
2-[butyl(methyl)amino]-5-[(3-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146054998) has the molecular formula C21H25F3N2O6S and a molecular weight of 490.50 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]-5-[(3-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[butyl(methyl)amino]-5-[(3-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146054998 |
| Molecular Formula | C21H25F3N2O6S |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[butyl(methyl)amino]-5-[(3-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCN(C)c1ccc(NS(=O)(=O)c2cccc(C)c2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N2O4S.C2HF3O2/c1-4-5-11-21(3)18-10-9-15(13-17(18)19(22)23)20-26(24,25)16-8-6-7-14(2)12-16;3-2(4,5)1(6)7/h6-10,12-13,20H,4-5,11H2,1-3H3,(H,22,23);(H,6,7) |
| InChIKey | UCLCUGXPPUSVSD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|