C20H23F3N2O6S — CID 146055369
2-(diethylamino)-5-[(3-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055369) has the molecular formula C20H23F3N2O6S and a molecular weight of 476.47 g/mol. Its IUPAC name is 2-(diethylamino)-5-[(3-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(diethylamino)-5-[(3-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055369 |
| Molecular Formula | C20H23F3N2O6S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-(diethylamino)-5-[(3-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)c2cccc(C)c2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N2O4S.C2HF3O2/c1-4-20(5-2)17-10-9-14(12-16(17)18(21)22)19-25(23,24)15-8-6-7-13(3)11-15;3-2(4,5)1(6)7/h6-12,19H,4-5H2,1-3H3,(H,21,22);(H,6,7) |
| InChIKey | QQTQEUJSHJCHSN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|