C19H19F5N2O6S — CID 146055375
2-(diethylamino)-5-[(3,4-difluorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055375) has the molecular formula C19H19F5N2O6S and a molecular weight of 498.43 g/mol. Its IUPAC name is 2-(diethylamino)-5-[(3,4-difluorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(diethylamino)-5-[(3,4-difluorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055375 |
| Molecular Formula | C19H19F5N2O6S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 2-(diethylamino)-5-[(3,4-difluorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H18F2N2O4S.C2HF3O2/c1-3-21(4-2)16-8-5-11(9-13(16)17(22)23)20-26(24,25)12-6-7-14(18)15(19)10-12;3-2(4,5)1(6)7/h5-10,20H,3-4H2,1-2H3,(H,22,23);(H,6,7) |
| InChIKey | ZLOYNAVQASAKFF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|