C27H29F3N2O6S — CID 146055281
2-[benzyl(butyl)amino]-5-[(4-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055281) has the molecular formula C27H29F3N2O6S and a molecular weight of 566.60 g/mol. Its IUPAC name is 2-[benzyl(butyl)amino]-5-[(4-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[benzyl(butyl)amino]-5-[(4-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055281 |
| Molecular Formula | C27H29F3N2O6S |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 2-[benzyl(butyl)amino]-5-[(4-methylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCN(Cc1ccccc1)c1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H28N2O4S.C2HF3O2/c1-3-4-16-27(18-20-8-6-5-7-9-20)24-15-12-21(17-23(24)25(28)29)26-32(30,31)22-13-10-19(2)11-14-22;3-2(4,5)1(6)7/h5-15,17,26H,3-4,16,18H2,1-2H3,(H,28,29);(H,6,7) |
| InChIKey | HADMTNMXKSIDKP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|