C26H27F3N2O6S — CID 146054939
2-[benzyl(ethyl)amino]-5-[(3,5-dimethylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146054939) has the molecular formula C26H27F3N2O6S and a molecular weight of 552.57 g/mol. Its IUPAC name is 2-[benzyl(ethyl)amino]-5-[(3,5-dimethylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[benzyl(ethyl)amino]-5-[(3,5-dimethylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146054939 |
| Molecular Formula | C26H27F3N2O6S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 2-[benzyl(ethyl)amino]-5-[(3,5-dimethylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCN(Cc1ccccc1)c1ccc(NS(=O)(=O)c2cc(C)cc(C)c2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H26N2O4S.C2HF3O2/c1-4-26(16-19-8-6-5-7-9-19)23-11-10-20(15-22(23)24(27)28)25-31(29,30)21-13-17(2)12-18(3)14-21;3-2(4,5)1(6)7/h5-15,25H,4,16H2,1-3H3,(H,27,28);(H,6,7) |
| InChIKey | UKUYMQRUKOLMPX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|