C23H19Cl2F3N2O6S — CID 146055100
2-[benzyl(methyl)amino]-5-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055100) has the molecular formula C23H19Cl2F3N2O6S and a molecular weight of 579.38 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-5-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[benzyl(methyl)amino]-5-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055100 |
| Molecular Formula | C23H19Cl2F3N2O6S |
| Molecular Weight | 579.38 g/mol |
| Exact Mass | 578.03 |
| IUPAC Name | 2-[benzyl(methyl)amino]-5-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CN(Cc1ccccc1)c1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H18Cl2N2O4S.C2HF3O2/c1-25(13-14-5-3-2-4-6-14)20-10-7-15(11-17(20)21(26)27)24-30(28,29)16-8-9-18(22)19(23)12-16;3-2(4,5)1(6)7/h2-12,24H,13H2,1H3,(H,26,27);(H,6,7) |
| InChIKey | HHVSNYFQVKMDLT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|