C22H20F2N2O4S — CID 50766424
2-[benzyl(ethyl)amino]-5-[(3,4-difluorophenyl)sulfonylamino]benzoic acid (PubChem CID 50766424) has the molecular formula C22H20F2N2O4S and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-[benzyl(ethyl)amino]-5-[(3,4-difluorophenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[benzyl(ethyl)amino]-5-[(3,4-difluorophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766424 |
| Molecular Formula | C22H20F2N2O4S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[benzyl(ethyl)amino]-5-[(3,4-difluorophenyl)sulfonylamino]benzoic acid |
| SMILES | CCN(Cc1ccccc1)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1C(=O)O |
| InChI | InChI=1S/C22H20F2N2O4S/c1-2-26(14-15-6-4-3-5-7-15)21-11-8-16(12-18(21)22(27)28)25-31(29,30)17-9-10-19(23)20(24)13-17/h3-13,25H,2,14H2,1H3,(H,27,28) |
| InChIKey | MSRRSLITLSUSJL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|