C17H18F2N2O4S — CID 50766693
2-(diethylamino)-5-[(2,5-difluorophenyl)sulfonylamino]benzoic acid (PubChem CID 50766693) has the molecular formula C17H18F2N2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-(diethylamino)-5-[(2,5-difluorophenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-(diethylamino)-5-[(2,5-difluorophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766693 |
| Molecular Formula | C17H18F2N2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-(diethylamino)-5-[(2,5-difluorophenyl)sulfonylamino]benzoic acid |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)c2cc(F)ccc2F)cc1C(=O)O |
| InChI | InChI=1S/C17H18F2N2O4S/c1-3-21(4-2)15-8-6-12(10-13(15)17(22)23)20-26(24,25)16-9-11(18)5-7-14(16)19/h5-10,20H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | IWKVSTRVVYDWQZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|