C22H29FN2O4S — CID 50766745
2-[bis(2-methylpropyl)amino]-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 50766745) has the molecular formula C22H29FN2O4S and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-[bis(2-methylpropyl)amino]-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[bis(2-methylpropyl)amino]-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766745 |
| Molecular Formula | C22H29FN2O4S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[bis(2-methylpropyl)amino]-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)Nc1ccc(N(CC(C)C)CC(C)C)c(C(=O)O)c1 |
| InChI | InChI=1S/C22H29FN2O4S/c1-14(2)12-25(13-15(3)4)20-9-8-18(11-19(20)22(26)27)24-30(28,29)21-10-17(23)7-6-16(21)5/h6-11,14-15,24H,12-13H2,1-5H3,(H,26,27) |
| InChIKey | DENQWXDHXPSJJR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|