C24H29FN4O4S — CID 50766944
2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl-methylamino]-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 50766944) has the molecular formula C24H29FN4O4S and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl-methylamino]-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl-methylamino]-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766944 |
| Molecular Formula | C24H29FN4O4S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 2-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl-methylamino]-5-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | CCn1nc(C)c(CCN(C)c2ccc(NS(=O)(=O)c3cc(F)ccc3C)cc2C(=O)O)c1C |
| InChI | InChI=1S/C24H29FN4O4S/c1-6-29-17(4)20(16(3)26-29)11-12-28(5)22-10-9-19(14-21(22)24(30)31)27-34(32,33)23-13-18(25)8-7-15(23)2/h7-10,13-14,27H,6,11-12H2,1-5H3,(H,30,31) |
| InChIKey | LXHLZXBHWMMJTG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|