C27H33F3N4O6S — CID 146055449
5-[(3,4-dimethylphenyl)sulfonylamino]-2-[methyl-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055449) has the molecular formula C27H33F3N4O6S and a molecular weight of 598.64 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenyl)sulfonylamino]-2-[methyl-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(3,4-dimethylphenyl)sulfonylamino]-2-[methyl-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055449 |
| Molecular Formula | C27H33F3N4O6S |
| Molecular Weight | 598.64 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 5-[(3,4-dimethylphenyl)sulfonylamino]-2-[methyl-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N(C)CCCc3c(C)nn(C)c3C)c(C(=O)O)c2)cc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H32N4O4S.C2HF3O2/c1-16-9-11-21(14-17(16)2)34(32,33)27-20-10-12-24(23(15-20)25(30)31)28(5)13-7-8-22-18(3)26-29(6)19(22)4;3-2(4,5)1(6)7/h9-12,14-15,27H,7-8,13H2,1-6H3,(H,30,31);(H,6,7) |
| InChIKey | XGFVLMOWYDSDDR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|