C21H21F2N3O5S — CID 46292317
5-[(2,5-difluorophenyl)sulfonylamino]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]benzoic acid (PubChem CID 46292317) has the molecular formula C21H21F2N3O5S and a molecular weight of 465.48 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)sulfonylamino]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]benzoic acid.
| Compound Name | 5-[(2,5-difluorophenyl)sulfonylamino]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 46292317 |
| Molecular Formula | C21H21F2N3O5S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 5-[(2,5-difluorophenyl)sulfonylamino]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]benzoic acid |
| SMILES | Cc1noc(C)c1CCN(C)c1ccc(NS(=O)(=O)c2cc(F)ccc2F)cc1C(=O)O |
| InChI | InChI=1S/C21H21F2N3O5S/c1-12-16(13(2)31-24-12)8-9-26(3)19-7-5-15(11-17(19)21(27)28)25-32(29,30)20-10-14(22)4-6-18(20)23/h4-7,10-11,25H,8-9H2,1-3H3,(H,27,28) |
| InChIKey | FCFNAWOVEPTNEN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|