C25H31N3O5S — CID 46292313
2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]-5-[[4-(2-methylpropyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 46292313) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]-5-[[4-(2-methylpropyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]-5-[[4-(2-methylpropyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46292313 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]-5-[[4-(2-methylpropyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | Cc1noc(C)c1CCN(C)c1ccc(NS(=O)(=O)c2ccc(CC(C)C)cc2)cc1C(=O)O |
| InChI | InChI=1S/C25H31N3O5S/c1-16(2)14-19-6-9-21(10-7-19)34(31,32)27-20-8-11-24(23(15-20)25(29)30)28(5)13-12-22-17(3)26-33-18(22)4/h6-11,15-16,27H,12-14H2,1-5H3,(H,29,30) |
| InChIKey | RKZLBXCJMASBGE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|