C22H22ClN3O4 — CID 50807092
5-[(4-chlorobenzoyl)amino]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]benzoic acid (PubChem CID 50807092) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 5-[(4-chlorobenzoyl)amino]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]benzoic acid.
| Compound Name | 5-[(4-chlorobenzoyl)amino]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 50807092 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 5-[(4-chlorobenzoyl)amino]-2-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl-methylamino]benzoic acid |
| SMILES | Cc1noc(C)c1CCN(C)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C22H22ClN3O4/c1-13-18(14(2)30-25-13)10-11-26(3)20-9-8-17(12-19(20)22(28)29)24-21(27)15-4-6-16(23)7-5-15/h4-9,12H,10-11H2,1-3H3,(H,24,27)(H,28,29) |
| InChIKey | JZDQRZIKDDGQBY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|