C18H16BrN3O3 — CID 50807373
5-[(4-bromobenzoyl)amino]-2-[2-cyanoethyl(methyl)amino]benzoic acid (PubChem CID 50807373) has the molecular formula C18H16BrN3O3 and a molecular weight of 402.25 g/mol. Its IUPAC name is 5-[(4-bromobenzoyl)amino]-2-[2-cyanoethyl(methyl)amino]benzoic acid.
| Compound Name | 5-[(4-bromobenzoyl)amino]-2-[2-cyanoethyl(methyl)amino]benzoic acid |
|---|---|
| PubChem CID | 50807373 |
| Molecular Formula | C18H16BrN3O3 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 5-[(4-bromobenzoyl)amino]-2-[2-cyanoethyl(methyl)amino]benzoic acid |
| SMILES | CN(CCC#N)c1ccc(NC(=O)c2ccc(Br)cc2)cc1C(=O)O |
| InChI | InChI=1S/C18H16BrN3O3/c1-22(10-2-9-20)16-8-7-14(11-15(16)18(24)25)21-17(23)12-3-5-13(19)6-4-12/h3-8,11H,2,10H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | BCQHDQFSBGWBEL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|