C22H25F3N2O5 — CID 146060484
2-[butyl(methyl)amino]-5-[(3-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060484) has the molecular formula C22H25F3N2O5 and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]-5-[(3-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[butyl(methyl)amino]-5-[(3-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060484 |
| Molecular Formula | C22H25F3N2O5 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[butyl(methyl)amino]-5-[(3-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCN(C)c1ccc(NC(=O)c2cccc(C)c2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H24N2O3.C2HF3O2/c1-4-5-11-22(3)18-10-9-16(13-17(18)20(24)25)21-19(23)15-8-6-7-14(2)12-15;3-2(4,5)1(6)7/h6-10,12-13H,4-5,11H2,1-3H3,(H,21,23)(H,24,25);(H,6,7) |
| InChIKey | YYHADODCYKKHRT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|