C21H24N2O5 — CID 94083671
2-[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]-5-[(3-methylbenzoyl)amino]benzoic acid (PubChem CID 94083671) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]-5-[(3-methylbenzoyl)amino]benzoic acid.
| Compound Name | 2-[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]-5-[(3-methylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 94083671 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[[(2S)-1,4-dioxan-2-yl]methyl-methylamino]-5-[(3-methylbenzoyl)amino]benzoic acid |
| SMILES | Cc1cccc(C(=O)Nc2ccc(N(C)C[C@H]3COCCO3)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-14-4-3-5-15(10-14)20(24)22-16-6-7-19(18(11-16)21(25)26)23(2)12-17-13-27-8-9-28-17/h3-7,10-11,17H,8-9,12-13H2,1-2H3,(H,22,24)(H,25,26)/t17-/m0/s1 |
| InChIKey | LWTOENSJVXDVCB-KRWDZBQOSA-N |
| XLogP | 2.80 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|