C23H25F3N2O7 — CID 146060836
2-[1,4-dioxan-2-ylmethyl(methyl)amino]-5-[(2-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060836) has the molecular formula C23H25F3N2O7 and a molecular weight of 498.45 g/mol. Its IUPAC name is 2-[1,4-dioxan-2-ylmethyl(methyl)amino]-5-[(2-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[1,4-dioxan-2-ylmethyl(methyl)amino]-5-[(2-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060836 |
| Molecular Formula | C23H25F3N2O7 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 2-[1,4-dioxan-2-ylmethyl(methyl)amino]-5-[(2-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(N(C)CC2COCCO2)c(C(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H24N2O5.C2HF3O2/c1-14-5-3-4-6-17(14)20(24)22-15-7-8-19(18(11-15)21(25)26)23(2)12-16-13-27-9-10-28-16;3-2(4,5)1(6)7/h3-8,11,16H,9-10,12-13H2,1-2H3,(H,22,24)(H,25,26);(H,6,7) |
| InChIKey | KWXBYOCDMJIMSE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|