C28H28F3N3O6 — CID 146060590
2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060590) has the molecular formula C28H28F3N3O6 and a molecular weight of 559.54 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060590 |
| Molecular Formula | C28H28F3N3O6 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(2-methylbenzoyl)amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccccc3C)cc2C(=O)O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H27N3O4.C2HF3O2/c1-18-7-3-4-8-20(18)25(30)27-19-11-12-22(21(17-19)26(31)32)28-13-15-29(16-14-28)23-9-5-6-10-24(23)33-2;3-2(4,5)1(6)7/h3-12,17H,13-16H2,1-2H3,(H,27,30)(H,31,32);(H,6,7) |
| InChIKey | UHXUJPMZLKARNK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|