C21H26N2O3 — CID 50807457
2-(dipropylamino)-5-[(2-methylbenzoyl)amino]benzoic acid (PubChem CID 50807457) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-(dipropylamino)-5-[(2-methylbenzoyl)amino]benzoic acid.
| Compound Name | 2-(dipropylamino)-5-[(2-methylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 50807457 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-(dipropylamino)-5-[(2-methylbenzoyl)amino]benzoic acid |
| SMILES | CCCN(CCC)c1ccc(NC(=O)c2ccccc2C)cc1C(=O)O |
| InChI | InChI=1S/C21H26N2O3/c1-4-12-23(13-5-2)19-11-10-16(14-18(19)21(25)26)22-20(24)17-9-7-6-8-15(17)3/h6-11,14H,4-5,12-13H2,1-3H3,(H,22,24)(H,25,26) |
| InChIKey | PFNAZMSAFRUDDC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|