C20H23F3N2O5S — CID 146060548
2-(dipropylamino)-5-(thiophene-2-carbonylamino)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060548) has the molecular formula C20H23F3N2O5S and a molecular weight of 460.47 g/mol. Its IUPAC name is 2-(dipropylamino)-5-(thiophene-2-carbonylamino)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(dipropylamino)-5-(thiophene-2-carbonylamino)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060548 |
| Molecular Formula | C20H23F3N2O5S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-(dipropylamino)-5-(thiophene-2-carbonylamino)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCN(CCC)c1ccc(NC(=O)c2cccs2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N2O3S.C2HF3O2/c1-3-9-20(10-4-2)15-8-7-13(12-14(15)18(22)23)19-17(21)16-6-5-11-24-16;3-2(4,5)1(6)7/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,19,21)(H,22,23);(H,6,7) |
| InChIKey | NMXPIUPXHDKQRJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|