C24H31F3N2O6S — CID 146055104
2-(dipropylamino)-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055104) has the molecular formula C24H31F3N2O6S and a molecular weight of 532.58 g/mol. Its IUPAC name is 2-(dipropylamino)-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(dipropylamino)-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055104 |
| Molecular Formula | C24H31F3N2O6S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 2-(dipropylamino)-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCN(CCC)c1ccc(NS(=O)(=O)c2c(C)cc(C)cc2C)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H30N2O4S.C2HF3O2/c1-6-10-24(11-7-2)20-9-8-18(14-19(20)22(25)26)23-29(27,28)21-16(4)12-15(3)13-17(21)5;3-2(4,5)1(6)7/h8-9,12-14,23H,6-7,10-11H2,1-5H3,(H,25,26);(H,6,7) |
| InChIKey | YKXVRSBZODDQTE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|