C23H27FN4O4S — CID 50766824
5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[methyl-[(5-methyl-2-propylpyrazol-3-yl)methyl]amino]benzoic acid (PubChem CID 50766824) has the molecular formula C23H27FN4O4S and a molecular weight of 474.56 g/mol. Its IUPAC name is 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[methyl-[(5-methyl-2-propylpyrazol-3-yl)methyl]amino]benzoic acid.
| Compound Name | 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[methyl-[(5-methyl-2-propylpyrazol-3-yl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 50766824 |
| Molecular Formula | C23H27FN4O4S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[methyl-[(5-methyl-2-propylpyrazol-3-yl)methyl]amino]benzoic acid |
| SMILES | CCCn1nc(C)cc1CN(C)c1ccc(NS(=O)(=O)c2cc(F)ccc2C)cc1C(=O)O |
| InChI | InChI=1S/C23H27FN4O4S/c1-5-10-28-19(11-16(3)25-28)14-27(4)21-9-8-18(13-20(21)23(29)30)26-33(31,32)22-12-17(24)7-6-15(22)2/h6-9,11-13,26H,5,10,14H2,1-4H3,(H,29,30) |
| InChIKey | QLEBTQLVDAPESE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|