C25H28N2O4S — CID 50766736
2-[benzyl(butyl)amino]-5-[(3-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 50766736) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[benzyl(butyl)amino]-5-[(3-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[benzyl(butyl)amino]-5-[(3-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766736 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[benzyl(butyl)amino]-5-[(3-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | CCCCN(Cc1ccccc1)c1ccc(NS(=O)(=O)c2cccc(C)c2)cc1C(=O)O |
| InChI | InChI=1S/C25H28N2O4S/c1-3-4-15-27(18-20-10-6-5-7-11-20)24-14-13-21(17-23(24)25(28)29)26-32(30,31)22-12-8-9-19(2)16-22/h5-14,16-17,26H,3-4,15,18H2,1-2H3,(H,28,29) |
| InChIKey | VQVDRCBBOBNTDJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|