C22H20Cl2N2O3S — CID 27666170
N-benzyl-2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-methylacetamide (PubChem CID 27666170) has the molecular formula C22H20Cl2N2O3S and a molecular weight of 463.39 g/mol. Its IUPAC name is N-benzyl-2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-methylacetamide.
| Compound Name | N-benzyl-2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 27666170 |
| Molecular Formula | C22H20Cl2N2O3S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-benzyl-2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-methylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)Cc1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H20Cl2N2O3S/c1-26(15-17-5-3-2-4-6-17)22(27)13-16-7-9-18(10-8-16)25-30(28,29)19-11-12-20(23)21(24)14-19/h2-12,14,25H,13,15H2,1H3 |
| InChIKey | MCICPCIGZXJVAL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |