C17H17Cl2N3O5S — CID 43002856
ethyl N-[[2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]acetyl]amino]carbamate (PubChem CID 43002856) has the molecular formula C17H17Cl2N3O5S and a molecular weight of 446.31 g/mol. Its IUPAC name is ethyl N-[[2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]acetyl]amino]carbamate.
| Compound Name | ethyl N-[[2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]acetyl]amino]carbamate |
|---|---|
| PubChem CID | 43002856 |
| Molecular Formula | C17H17Cl2N3O5S |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | ethyl N-[[2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]acetyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)Cc1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O5S/c1-2-27-17(24)21-20-16(23)9-11-3-5-12(6-4-11)22-28(25,26)13-7-8-14(18)15(19)10-13/h3-8,10,22H,2,9H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | KVYZSICJMRVIRQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|