C23H21Cl2NO2S2 — CID 162264175
N-(3,4-dichlorophenyl)-4-[3-(4-ethylphenyl)-2-sulfanylidenepropyl]benzenesulfonamide (PubChem CID 162264175) has the molecular formula C23H21Cl2NO2S2 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-[3-(4-ethylphenyl)-2-sulfanylidenepropyl]benzenesulfonamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-[3-(4-ethylphenyl)-2-sulfanylidenepropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162264175 |
| Molecular Formula | C23H21Cl2NO2S2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-[3-(4-ethylphenyl)-2-sulfanylidenepropyl]benzenesulfonamide |
| SMILES | CCc1ccc(CC(=S)Cc2ccc(S(=O)(=O)Nc3ccc(Cl)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C23H21Cl2NO2S2/c1-2-16-3-5-17(6-4-16)13-20(29)14-18-7-10-21(11-8-18)30(27,28)26-19-9-12-22(24)23(25)15-19/h3-12,15,26H,2,13-14H2,1H3 |
| InChIKey | ZZQZBGSHRPSCRC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|