C21H17Cl2NO2S2 — CID 147069506
4-[3-(2,5-dichlorophenyl)-2-sulfanylidenepropyl]-N-phenylbenzenesulfonamide (PubChem CID 147069506) has the molecular formula C21H17Cl2NO2S2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 4-[3-(2,5-dichlorophenyl)-2-sulfanylidenepropyl]-N-phenylbenzenesulfonamide.
| Compound Name | 4-[3-(2,5-dichlorophenyl)-2-sulfanylidenepropyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 147069506 |
| Molecular Formula | C21H17Cl2NO2S2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | 4-[3-(2,5-dichlorophenyl)-2-sulfanylidenepropyl]-N-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)c1ccc(CC(=S)Cc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H17Cl2NO2S2/c22-17-8-11-21(23)16(13-17)14-19(27)12-15-6-9-20(10-7-15)28(25,26)24-18-4-2-1-3-5-18/h1-11,13,24H,12,14H2 |
| InChIKey | BETKKIJFLXIJJL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|